|
CAS#: 35048-13-6 Product: 7-Chloro-5-Iodoquinolin-8-Ol No suppilers available for the product. |
| Name | 7-Chloro-5-Iodoquinolin-8-Ol |
|---|---|
| Synonyms | 7-Chloro-5-Iodo-Quinolin-8-Ol; 7-Chloro-5-Iodo-8-Quinolinol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5ClINO |
| Molecular Weight | 305.50 |
| CAS Registry Number | 35048-13-6 |
| SMILES | C1=CC=NC2=C(C(=CC(=C12)I)Cl)O |
| InChI | 1S/C9H5ClINO/c10-6-4-7(11)5-2-1-3-12-8(5)9(6)13/h1-4,13H |
| InChIKey | JBTWPGVHNYETNF-UHFFFAOYSA-N |
| Density | 2.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.003°C at 760 mmHg (Cal.) |
| Flash point | 192.086°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-5-Iodoquinolin-8-Ol |