|
CAS#: 35062-46-5 Product: 2-(1-Benzothiophen-3-Ylmethyl)-4-Pentenoic Acid No suppilers available for the product. |
| Name | 2-(1-Benzothiophen-3-Ylmethyl)-4-Pentenoic Acid |
|---|---|
| Synonyms | α-allylbenzo[b]thiophene-3-propionic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.32 |
| CAS Registry Number | 35062-46-5 |
| EINECS | 252-342-7 |
| SMILES | OC(=O)C(CC=C)Cc2csc1ccccc12 |
| InChI | 1S/C14H14O2S/c1-2-5-10(14(15)16)8-11-9-17-13-7-4-3-6-12(11)13/h2-4,6-7,9-10H,1,5,8H2,(H,15,16) |
| InChIKey | VUUQWXGBGKFKDF-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.776°C at 760 mmHg (Cal.) |
| Flash point | 205.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Benzothiophen-3-Ylmethyl)-4-Pentenoic Acid |