|
CAS#: 35116-30-4 Product: Disodium 1-Sulfonatocyclohexane-1-Carboxylate No suppilers available for the product. |
| Name | Disodium 1-Sulfonatocyclohexane-1-Carboxylate |
|---|---|
| Synonyms | Disodium 1-Sulfonato-1-Cyclohexanecarboxylate; Cyclohexanecarboxylic Acid, 1-Sulfo-, Disodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10Na2O5S |
| Molecular Weight | 252.19 |
| CAS Registry Number | 35116-30-4 |
| EINECS | 252-380-4 |
| SMILES | O=[S]([O-])(=O)C1(C([O-])=O)CCCCC1.[Na+].[Na+] |
| InChI | 1S/C7H12O5S.2Na/c8-6(9)7(13(10,11)12)4-2-1-3-5-7;;/h1-5H2,(H,8,9)(H,10,11,12);;/q;2*+1/p-2 |
| InChIKey | OSJHHINMNUYJSK-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Disodium 1-Sulfonatocyclohexane-1-Carboxylate |