|
CAS#: 35187-28-1 Product: 7,11-Dimethylbenzo[b]Phenanthrene No suppilers available for the product. |
| Name | 7,11-Dimethylbenzo[b]Phenanthrene |
|---|---|
| Synonyms | 8,10-Dimethyl-1,2-Benzanthracene; Brn 3277225; Benz(A)Anthracene, 7,11-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 35187-28-1 |
| SMILES | C1=CC=CC3=C1C2=CC4=C(C(=C2C=C3)C)C=CC=C4C |
| InChI | 1S/C20H16/c1-13-6-5-9-16-14(2)17-11-10-15-7-3-4-8-18(15)20(17)12-19(13)16/h3-12H,1-2H3 |
| InChIKey | CDDPPWIZRARCKC-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.461°C at 760 mmHg (Cal.) |
| Flash point | 227.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,11-Dimethylbenzo[b]Phenanthrene |