| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Propenoic Acid, Polymer With Ethenylbenzene, Ammonium Salt |
|---|---|
| Synonyms | Ammonium; Prop-2-Enoate; Styrene; Ammonium; Acrylate; Styrene |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 |
| CAS Registry Number | 35209-54-2 |
| SMILES | O=C([O-])C=C.C1=C(C=CC=C1)C=C.[NH4+] |
| InChI | 1S/C8H8.C3H4O2.H3N/c1-2-8-6-4-3-5-7-8;1-2-3(4)5;/h2-7H,1H2;2H,1H2,(H,4,5);1H3 |
| InChIKey | KKVDXUINSGVKCB-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propenoic Acid, Polymer With Ethenylbenzene, Ammonium Salt |