|
CAS#: 352535-89-8 Product: (2,3-Dichloro-4-Formylphenyl)Boronic Acid No suppilers available for the product. |
| Name | (2,3-Dichloro-4-Formylphenyl)Boronic Acid |
|---|---|
| Synonyms | (2,3-Dichlor-4-formylphenyl)borsäure; (2,3-Dichloro-4-formylphenyl)boronic acid; Acide (2,3-dichloro-4-formylphényl)boreique |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5BCl2O3 |
| Molecular Weight | 218.83 |
| CAS Registry Number | 352535-89-8 |
| SMILES | B(c1ccc(c(c1Cl)Cl)C=O)(O)O |
| InChI | 1S/C7H5BCl2O3/c9-6-4(3-11)1-2-5(7(6)10)8(12)13/h1-3,12-13H |
| InChIKey | CBQYHKZUDFPONU-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.7±55.0°C at 760 mmHg (Cal.) |
| Flash point | 199.8±31.5°C (Cal.) |
| Refractive index | 1.586 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2,3-Dichloro-4-Formylphenyl)Boronic Acid |