|
CAS#: 35281-25-5 Product: 9,14-Dihydrobenzo(b)Triphenylene No suppilers available for the product. |
| Name | 9,14-Dihydrobenzo(b)Triphenylene |
|---|---|
| Synonyms | 9,14-Dihydrodibenz(A,C)Anthracene; Benzo(B)Triphenylene, 9,14-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 35281-25-5 |
| SMILES | C1=CC2=C(C=C1)CC4=C(C2)C3=CC=CC=C3C5=C4C=CC=C5 |
| InChI | 1S/C22H16/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-12H,13-14H2 |
| InChIKey | KLFMBPASUWJAGD-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.35°C at 760 mmHg (Cal.) |
| Flash point | 239.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,14-Dihydrobenzo(b)Triphenylene |