Online Database of Chemicals from Around the World
|
CAS#: 35335-07-0 Product: 7,14-Dimethylnaphtho[1,2-b]Phenanthrene No suppilers available for the product. |
| Name | 7,14-Dimethylnaphtho[1,2-b]Phenanthrene |
|---|---|
| Synonyms | 4-05-00-02739 (Beilstein Handbook Reference); 7,14-Dimethyldibenz(A,H)Anthracene; 9,10-Dimethyl-1,2,5,6-Dibenzanthracene |
| Molecular Structure | ![CAS#: 35335-07-0, 7,14-Dimethylnaphtho[1,2-b]Phenanthrene](/moreStructures/35335-07-0.gif) |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 |
| CAS Registry Number | 35335-07-0 |
| SMILES | C1=C3C(=C2C(=C1)C=CC=C2)C(=C4C(=C3C)C5=C(C=C4)C=CC=C5)C |
| InChI | 1S/C24H18/c1-15-19-13-11-18-8-4-6-10-22(18)24(19)16(2)20-14-12-17-7-3-5-9-21(17)23(15)20/h3-14H,1-2H3 |
| InChIKey | KFOMXRLGNXVJPI-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.802°C at 760 mmHg (Cal.) |
| Flash point | 279.775°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,14-Dimethylnaphtho[1,2-b]Phenanthrene |