|
CAS#: 35440-77-8 Product: Strontium 2-Sulfanylpropanoate No suppilers available for the product. |
| Name | Strontium 2-Sulfanylpropanoate |
|---|---|
| Synonyms | Strontium 2-Mercaptopropanoate; Strontium 2-Mercaptopropionate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10O4S2Sr |
| Molecular Weight | 297.88 |
| CAS Registry Number | 35440-77-8 |
| EINECS | 252-561-8 |
| SMILES | CC(S)C([O-])=O.CC(S)C([O-])=O.[Sr++] |
| InChI | 1S/2C3H6O2S.Sr/c2*1-2(6)3(4)5;/h2*2,6H,1H3,(H,4,5);/q;;+2/p-2 |
| InChIKey | UGGWBGCKROXODH-UHFFFAOYSA-L |
| Boiling point | 205.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 87°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Strontium 2-Sulfanylpropanoate |