|
CAS#: 35471-38-6 Product: Potassium 4-Chloro-2-Cyclopentylphenolate No suppilers available for the product. |
| Name | Potassium 4-Chloro-2-Cyclopentylphenolate |
|---|---|
| Synonyms | Potassium 4-Chloro-2-Cyclopentyl-Phenolate; Epa Pesticide Chemical Code 064214; Phenol, 4-Chloro-2-Cyclopentyl-, Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClKO |
| Molecular Weight | 234.77 |
| CAS Registry Number | 35471-38-6 |
| SMILES | C1=C(Cl)C=CC(=C1C2CCCC2)[O-].[K+] |
| InChI | 1S/C11H13ClO.K/c12-9-5-6-11(13)10(7-9)8-3-1-2-4-8;/h5-8,13H,1-4H2;/q;+1/p-1 |
| InChIKey | UWWWKAGUBAJHMQ-UHFFFAOYSA-M |
| Boiling point | 247.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 103.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 4-Chloro-2-Cyclopentylphenolate |