Online Database of Chemicals from Around the World
|
CAS#: 35490-04-1 Product: Methyl 2-Acetyl-5-Oxohexanoate No suppilers available for the product. |
| Name | Methyl 2-Acetyl-5-Oxohexanoate |
|---|---|
| Synonyms | Methyl 2-Acetyl-5-Oxo-Hexanoate; 2-Acetyl-5-Oxohexanoic Acid Methyl Ester; 2-Acetyl-5-Keto-Hexanoic Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 35490-04-1 |
| EINECS | 252-592-7 |
| SMILES | C(C(=O)C)CC(C(OC)=O)C(=O)C |
| InChI | 1S/C9H14O4/c1-6(10)4-5-8(7(2)11)9(12)13-3/h8H,4-5H2,1-3H3 |
| InChIKey | XMLGBZPOJUOGOO-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.242°C at 760 mmHg (Cal.) |
| Flash point | 124.332°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Acetyl-5-Oxohexanoate |