Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Bis(2,2,3,3,3-Pentafluoro-1-Oxopropyl) Peroxide |
|---|---|
| Synonyms | 2,2,3,3,3-Pentafluoropropaneperoxoic Acid (2,2,3,3,3-Pentafluoro-1-Oxopropyl) Ester; 2,2,3,3,3-Pentafluoroperoxypropionic Acid 2,2,3,3,3-Pentafluoropropanoyl Ester; Bis(Pentafluoropropionyl) Peroxide |
| Molecular Structure |  |
| Molecular Formula | C6F10O4 |
| Molecular Weight | 326.05 |
| CAS Registry Number | 356-45-6 |
| EINECS | 206-605-8 |
| SMILES | O=C(C(F)(F)C(F)(F)F)OOC(=O)C(F)(F)C(F)(F)F |
| InChI | 1S/C6F10O4/c7-3(8,5(11,12)13)1(17)19-20-2(18)4(9,10)6(14,15)16 |
| InChIKey | NHJFHUKLZMQIHN-UHFFFAOYSA-N |
| Density | 1.723g/cm3 (Cal.) |
|---|---|
| Boiling point | 96.571°C at 760 mmHg (Cal.) |
| Flash point | 13.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,2,3,3,3-Pentafluoro-1-Oxopropyl) Peroxide |