|
CAS#: 35652-13-2 Product: Methyl (2R)-2-Phenyl-2-[(2R)-Piperidin-2-Yl]Acetate Hydrochloride No suppilers available for the product. |
| Name | Methyl (2R)-2-Phenyl-2-[(2R)-Piperidin-2-Yl]Acetate Hydrochloride |
|---|---|
| Synonyms | Methyl (2R)-2-Phenyl-2-[(2R)-2-Piperidyl]Acetate Hydrochloride; (2R)-2-Phenyl-2-[(2R)-2-Piperidinyl]Acetic Acid Methyl Ester Hydrochloride; (2R)-2-Phenyl-2-[(2R)-2-Piperidyl]Acetic Acid Methyl Ester Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 |
| CAS Registry Number | 35652-13-2 |
| SMILES | [C@H]1(NCCCC1)[C@@H](C2=CC=CC=C2)C(OC)=O.[H+].[Cl-] |
| InChI | 1S/C14H19NO2.ClH/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3;1H/t12-,13-;/m1./s1 |
| InChIKey | JUMYIBMBTDDLNG-OJERSXHUSA-N |
| Boiling point | 327.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2R)-2-Phenyl-2-[(2R)-Piperidin-2-Yl]Acetate Hydrochloride |