|
CAS#: 356529-10-7 Product: (2Z)-2-Chloro-3-Phenyl-1-(1-Pyrrolidinyl)-2-Propen-1-One No suppilers available for the product. |
| Name | (2Z)-2-Chloro-3-Phenyl-1-(1-Pyrrolidinyl)-2-Propen-1-One |
|---|---|
| Synonyms | (Z)-2-chloro-3-phenyl-1-(pyrrolidin-1-yl)prop-2-en-1-one; 1-(2-chloro-3-phenylacryloyl)pyrrolidine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 |
| CAS Registry Number | 356529-10-7 |
| SMILES | Cl/C(C(=O)N1CCCC1)=C\c2ccccc2 |
| InChI | 1S/C13H14ClNO/c14-12(10-11-6-2-1-3-7-11)13(16)15-8-4-5-9-15/h1-3,6-7,10H,4-5,8-9H2/b12-10- |
| InChIKey | QBDATSAUQQIXBM-BENRWUELSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.737°C at 760 mmHg (Cal.) |
| Flash point | 201.602°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-2-Chloro-3-Phenyl-1-(1-Pyrrolidinyl)-2-Propen-1-One |