|
CAS#: 3568-81-8 Product: 7-Hydroxyphenothiazin-3-One No suppilers available for the product. |
| Name | 7-Hydroxyphenothiazin-3-One |
|---|---|
| Synonyms | 7-Hydroxy-3-Phenothiazinone; 3H-Phenothiazin-3-One, 7-Hydroxy-; Ai3-03565 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7NO2S |
| Molecular Weight | 229.25 |
| CAS Registry Number | 3568-81-8 |
| SMILES | C1=C(C=CC3=C1SC2=CC(C=CC2=N3)=O)O |
| InChI | 1S/C12H7NO2S/c14-7-1-3-9-11(5-7)16-12-6-8(15)2-4-10(12)13-9/h1-6,14H |
| InChIKey | GSEOMGSFLQCKRO-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.273°C at 760 mmHg (Cal.) |
| Flash point | 215.231°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Hydroxyphenothiazin-3-One |