|
CAS#: 357-28-8 Product: 1,1,1,2,2-Pentafluoro-4-Methylpentan-3-One No suppilers available for the product. |
| Name | 1,1,1,2,2-Pentafluoro-4-Methylpentan-3-One |
|---|---|
| Synonyms | 1,1,1,2,2-Pentafluoro-4-Methyl-Pentan-3-One; Nsc42741 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7F5O |
| Molecular Weight | 190.11 |
| CAS Registry Number | 357-28-8 |
| SMILES | CC(C(C(C(F)(F)F)(F)F)=O)C |
| InChI | 1S/C6H7F5O/c1-3(2)4(12)5(7,8)6(9,10)11/h3H,1-2H3 |
| InChIKey | FCVMAXTWQAFQPW-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 87.842°C at 760 mmHg (Cal.) |
| Flash point | 23.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2-Pentafluoro-4-Methylpentan-3-One |