|
CAS#: 3573-01-1 Product: 3,10-Dichloro-5,12-Dihydroquinolino[2,3-b]Acridine-7,14-Dione No suppilers available for the product. |
| Name | 3,10-Dichloro-5,12-Dihydroquinolino[2,3-b]Acridine-7,14-Dione |
|---|---|
| Synonyms | 1/1/3573 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H10Cl2N2O2 |
| Molecular Weight | 381.21 |
| CAS Registry Number | 3573-01-1 |
| SMILES | Clc4cc5Nc3cc2C(=O)c1c(cc(Cl)cc1)Nc2cc3C(=O)c5cc4 |
| InChI | 1S/C20H10Cl2N2O2/c21-9-1-3-11-15(5-9)23-17-8-14-18(7-13(17)19(11)25)24-16-6-10(22)2-4-12(16)20(14)26/h1-8H,(H,23,25)(H,24,26) |
| InChIKey | UEPOQKGAZQWGDM-UHFFFAOYSA-N |
| Density | 1.515g/cm3 (Cal.) |
|---|---|
| Boiling point | 622.952°C at 760 mmHg (Cal.) |
| Flash point | 330.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,10-Dichloro-5,12-Dihydroquinolino[2,3-b]Acridine-7,14-Dione |