|
CAS#: 35749-21-4 Product: 2-Chloro-2-Nitrobutan-1-Ol No suppilers available for the product. |
| Name | 2-Chloro-2-Nitrobutan-1-Ol |
|---|---|
| Synonyms | 2-Chloro-2-Nitro-Butan-1-Ol; 1-Butanol,2-Chloro-2-Nitro-; 2-Chloro-2-Nitro-1-Butanol |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8ClNO3 |
| Molecular Weight | 153.57 |
| CAS Registry Number | 35749-21-4 |
| SMILES | C(O)C(Cl)([N+]([O-])=O)CC |
| InChI | 1S/C4H8ClNO3/c1-2-4(5,3-7)6(8)9/h7H,2-3H2,1H3 |
| InChIKey | AWPMTIPVNAOVJU-UHFFFAOYSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.439°C at 760 mmHg (Cal.) |
| Flash point | 90.143°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-2-Nitrobutan-1-Ol |