|
CAS#: 35787-74-7 Product: Bis(2-Methylphenyl) Hydrogen Phosphate No suppilers available for the product. |
| Name | Bis(2-Methylphenyl) Hydrogen Phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H15O4P |
| Molecular Weight | 278.24 |
| CAS Registry Number | 35787-74-7 |
| SMILES | C2=CC=C(O[P](OC1=CC=CC=C1C)(=O)O)C(=C2)C |
| InChI | 1S/C14H15O4P/c1-11-7-3-5-9-13(11)17-19(15,16)18-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H,15,16) |
| InChIKey | OHRCKPRYDGSBRN-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.504°C at 760 mmHg (Cal.) |
| Flash point | 200.856°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Methylphenyl) Hydrogen Phosphate |