|
CAS#: 35839-50-0 Product: Azanium 2,3-Dibromopropyl Sulfate No suppilers available for the product. |
| Name | Azanium 2,3-Dibromopropyl Sulfate |
|---|---|
| Synonyms | Ammonium 2,3-Dibromopropyl Sulfate; Ammonium 2,3-Dibromopropyl Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C3H9Br2NO4S |
| Molecular Weight | 314.98 |
| CAS Registry Number | 35839-50-0 |
| EINECS | 252-750-5 |
| SMILES | C(O[S]([O-])(=O)=O)C(Br)CBr.[NH4+] |
| InChI | 1S/C3H6Br2O4S.H3N/c4-1-3(5)2-9-10(6,7)8;/h3H,1-2H2,(H,6,7,8);1H3 |
| InChIKey | NUHVPBGWGITOKW-UHFFFAOYSA-N |
| Boiling point | 427.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 212.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azanium 2,3-Dibromopropyl Sulfate |