|
CAS#: 35892-17-2 Product: 2-Chloro-6-Nitro-N-Phenylaniline No suppilers available for the product. |
| Name | 2-Chloro-6-Nitro-N-Phenylaniline |
|---|---|
| Synonyms | 2-Chloro-6-Nitro-N-Phenyl-Aniline; (2-Chloro-6-Nitro-Phenyl)-Phenyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 |
| CAS Registry Number | 35892-17-2 |
| EINECS | 252-779-3 |
| SMILES | C1=CC=C([N+]([O-])=O)C(=C1Cl)NC2=CC=CC=C2 |
| InChI | 1S/C12H9ClN2O2/c13-10-7-4-8-11(15(16)17)12(10)14-9-5-2-1-3-6-9/h1-8,14H |
| InChIKey | KCIOLUSHFMDLKF-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.11°C at 760 mmHg (Cal.) |
| Flash point | 163.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-Nitro-N-Phenylaniline |