Online Database of Chemicals from Around the World
|
CAS#: 359-87-5 Product: 6,7-Dichloro-4H-Benzo[E][1,2,4]Thiadiazine 1,1-Dioxide No suppilers available for the product. |
| Name | 6,7-Dichloro-4H-Benzo[E][1,2,4]Thiadiazine 1,1-Dioxide |
|---|---|
| Synonyms | 2H-1,2,4-Benzothiadiazine, 6,7-Dichloro-, 1,1-Dioxide; 6,7-Dichloro-2H-1,2,4-Benzothiadiazine 1,1-Dioxide; 6,7-Dicloro-2H-1,2,4-Benzotiodiazina 1,1-Diossido [Italian] |
| Molecular Structure | ![CAS#: 359-87-5, 6,7-Dichloro-4H-Benzo[E][1,2,4]Thiadiazine 1,1-Dioxide](/moreStructures/359-87-5.gif) |
| Molecular Formula | C7H4Cl2N2O2S |
| Molecular Weight | 251.09 |
| CAS Registry Number | 359-87-5 |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)NC=N[S]2(=O)=O |
| InChI | 1S/C7H4Cl2N2O2S/c8-4-1-6-7(2-5(4)9)14(12,13)11-3-10-6/h1-3H,(H,10,11) |
| InChIKey | AOSLDRBVMZNIQT-UHFFFAOYSA-N |
| Density | 1.838g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.81°C at 760 mmHg (Cal.) |
| Flash point | 221.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dichloro-4H-Benzo[E][1,2,4]Thiadiazine 1,1-Dioxide |