|
CAS#: 35944-82-2 Product: N-Ethyl-(2,4,5-Trichlorophenoxy)Phosphonamidic Acid No suppilers available for the product. |
| Name | N-Ethyl-(2,4,5-Trichlorophenoxy)Phosphonamidic Acid |
|---|---|
| Synonyms | Dowco 160; Phosphoramidic Acid, Ethyl-, (2,4,5-Trichlorophenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9Cl3NO3P |
| Molecular Weight | 304.50 |
| CAS Registry Number | 35944-82-2 |
| SMILES | C1=C(O[P](=O)(NCC)O)C(=CC(=C1Cl)Cl)Cl |
| InChI | 1S/C8H9Cl3NO3P/c1-2-12-16(13,14)15-8-4-6(10)5(9)3-7(8)11/h3-4H,2H2,1H3,(H2,12,13,14) |
| InChIKey | USVLJVIGRGWNOT-UHFFFAOYSA-N |
| Density | 1.551g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.246°C at 760 mmHg (Cal.) |
| Flash point | 200.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-(2,4,5-Trichlorophenoxy)Phosphonamidic Acid |