|
CAS#: 36043-87-5 Product: Trimethyl-Phenethylazanium Bromide No suppilers available for the product. |
| Name | Trimethyl-Phenethylazanium Bromide |
|---|---|
| Synonyms | Trimethyl-Phenethyl-Ammonium Bromide; Trimethyl-Phenethylammonium Bromide; Trimethyl-Phenethyl-Azanium Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18BrN |
| Molecular Weight | 244.17 |
| CAS Registry Number | 36043-87-5 |
| EINECS | 252-844-6 |
| SMILES | C1=CC=CC=C1CC[N+](C)(C)C.[Br-] |
| InChI | 1S/C11H18N.BrH/c1-12(2,3)10-9-11-7-5-4-6-8-11;/h4-8H,9-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZOMFHATVODXRID-UHFFFAOYSA-M |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Trimethyl-Phenethylazanium Bromide |