|
CAS#: 36065-30-2 Product: 1,3,5-Tribromo-2-(2,3-Dibromo-2-Methylpropoxy)Benzene No suppilers available for the product. |
| Name | 1,3,5-Tribromo-2-(2,3-Dibromo-2-Methylpropoxy)Benzene |
|---|---|
| Synonyms | 1,3,5-Tribromo-2-(2,3-Dibromo-2-Methyl-Propoxy)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Br5O |
| Molecular Weight | 544.70 |
| CAS Registry Number | 36065-30-2 |
| EINECS | 252-859-8 |
| SMILES | C1=C(C(=C(C=C1Br)Br)OCC(CBr)(Br)C)Br |
| InChI | 1S/C10H9Br5O/c1-10(15,4-11)5-16-9-7(13)2-6(12)3-8(9)14/h2-3H,4-5H2,1H3 |
| InChIKey | WNMLTOIDDCEBNY-UHFFFAOYSA-N |
| Density | 2.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.66°C at 760 mmHg (Cal.) |
| Flash point | 187.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tribromo-2-(2,3-Dibromo-2-Methylpropoxy)Benzene |