|
CAS#: 36090-38-7 Product: 3-Chloro-4-(2-Oxo-4-Phenylpyrrolidin-1-Yl)Benzenesulfonamide No suppilers available for the product. |
| Name | 3-Chloro-4-(2-Oxo-4-Phenylpyrrolidin-1-Yl)Benzenesulfonamide |
|---|---|
| Synonyms | 3-Chloro-4-(2-Oxo-4-Phenyl-Pyrrolidin-1-Yl)Benzenesulfonamide; 3-Chloro-4-(2-Oxo-4-Phenyl-1-Pyrrolidinyl)Benzenesulfonamide; 3-Chloro-4-(2-Keto-4-Phenyl-Pyrrolidin-1-Yl)Benzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15ClN2O3S |
| Molecular Weight | 350.82 |
| CAS Registry Number | 36090-38-7 |
| SMILES | C1=C(C(=CC=C1[S](=O)(=O)N)N2C(CC(C2)C3=CC=CC=C3)=O)Cl |
| InChI | 1S/C16H15ClN2O3S/c17-14-9-13(23(18,21)22)6-7-15(14)19-10-12(8-16(19)20)11-4-2-1-3-5-11/h1-7,9,12H,8,10H2,(H2,18,21,22) |
| InChIKey | FZCFANZSYCSMLI-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 642.686°C at 760 mmHg (Cal.) |
| Flash point | 342.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-(2-Oxo-4-Phenylpyrrolidin-1-Yl)Benzenesulfonamide |