|
CAS#: 3615-55-2 Product: (2,3,4-Trihydroxy-5-Oxopentyl) Dihydrogen Phosphate No suppilers available for the product. |
| Name | (2,3,4-Trihydroxy-5-Oxopentyl) Dihydrogen Phosphate |
|---|---|
| Synonyms | (2,3,4-Trihydroxy-5-Oxo-Pentyl) Dihydrogen Phosphate; (2,3,4-Trihydroxy-5-Keto-Pentyl) Dihydrogen Phosphate; C01112 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H11O8P |
| Molecular Weight | 230.11 |
| CAS Registry Number | 3615-55-2 |
| SMILES | C(C(O)C(O)C(O)C=O)O[P](O)(O)=O |
| InChI | 1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12) |
| InChIKey | PPQRONHOSHZGFQ-UHFFFAOYSA-N |
| Density | 1.804g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.11°C at 760 mmHg (Cal.) |
| Flash point | 291.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3,4-Trihydroxy-5-Oxopentyl) Dihydrogen Phosphate |