|
CAS#: 36266-98-5 Product: Bis(2-Methylpropyl) 5,5,5-Trichloropentyl Phosphate No suppilers available for the product. |
| Name | Bis(2-Methylpropyl) 5,5,5-Trichloropentyl Phosphate |
|---|---|
| Synonyms | Diisobutyl 5,5,5-Trichloropentyl Phosphate; Phosphoric Acid Diisobutyl 5,5,5-Trichloropentyl Ester; Brn 1983557 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H26Cl3O4P |
| Molecular Weight | 383.68 |
| CAS Registry Number | 36266-98-5 |
| SMILES | C(O[P](=O)(OCC(C)C)OCC(C)C)CCCC(Cl)(Cl)Cl |
| InChI | 1S/C13H26Cl3O4P/c1-11(2)9-19-21(17,20-10-12(3)4)18-8-6-5-7-13(14,15)16/h11-12H,5-10H2,1-4H3 |
| InChIKey | FQICHYIADSNWBX-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.892°C at 760 mmHg (Cal.) |
| Flash point | 311.056°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Methylpropyl) 5,5,5-Trichloropentyl Phosphate |