|
CAS#: 36298-19-8 Product: 2-(3-Phenylpropylamino)Guanidine Hydrochloride No suppilers available for the product. |
| Name | 2-(3-Phenylpropylamino)Guanidine Hydrochloride |
|---|---|
| Synonyms | Sah-43522; 1-(3-Phenylpropylamino)Guanidine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17ClN4 |
| Molecular Weight | 228.72 |
| CAS Registry Number | 36298-19-8 |
| EINECS | 250-256-4 |
| SMILES | [H+].C1=C(CCCNN=C(N)N)C=CC=C1.[Cl-] |
| InChI | 1S/C10H16N4.ClH/c11-10(12)14-13-8-4-7-9-5-2-1-3-6-9;/h1-3,5-6,13H,4,7-8H2,(H4,11,12,14);1H |
| InChIKey | UFSCCUHWJJVNLJ-UHFFFAOYSA-N |
| Boiling point | 365.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Phenylpropylamino)Guanidine Hydrochloride |