|
CAS#: 36342-13-9 Product: 3-Chloro-1-(4-Methoxyphenyl)Pyrrolidine-2,5-Dione No suppilers available for the product. |
| Name | 3-Chloro-1-(4-Methoxyphenyl)Pyrrolidine-2,5-Dione |
|---|---|
| Synonyms | 3-Chloro-1-(4-Methoxyphenyl)Pyrrolidine-2,5-Quinone; 4-21-00-04578 (Beilstein Handbook Reference); Brn 0210254 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 |
| CAS Registry Number | 36342-13-9 |
| SMILES | C1=CC(=CC=C1N2C(CC(C2=O)Cl)=O)OC |
| InChI | 1S/C11H10ClNO3/c1-16-8-4-2-7(3-5-8)13-10(14)6-9(12)11(13)15/h2-5,9H,6H2,1H3 |
| InChIKey | UKFITXSLZKBHSN-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.642°C at 760 mmHg (Cal.) |
| Flash point | 251.741°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-1-(4-Methoxyphenyl)Pyrrolidine-2,5-Dione |