|
CAS#: 36384-00-6 Product: 1-Methyl-3-Phenyl-2,3-Dihydro-4(1H)-Quinazolinone No suppilers available for the product. |
| Name | 1-Methyl-3-Phenyl-2,3-Dihydro-4(1H)-Quinazolinone |
|---|---|
| Synonyms | 1-Methyl-3-phenyl-2,3-dihydro-4(1H)-quinazolinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.28 |
| CAS Registry Number | 36384-00-6 |
| SMILES | O=C2c1c(cccc1)N(CN2c3ccccc3)C |
| InChI | 1S/C15H14N2O/c1-16-11-17(12-7-3-2-4-8-12)15(18)13-9-5-6-10-14(13)16/h2-10H,11H2,1H3 |
| InChIKey | QDXNYARAZPEZBW-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.793°C at 760 mmHg (Cal.) |
| Flash point | 188.408°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-Phenyl-2,3-Dihydro-4(1H)-Quinazolinone |