| Name | (2E,6E,9E)-3,7-Dimethyl-8,11-Dioxododeca-2,6,9-Trienal |
|---|---|
| Synonyms | (2E,6E,9E)-3,7-Dimethyl-8,11-Dioxo-Dodeca-2,6,9-Trienal; (2E,6E,9E)-8,11-Diketo-3,7-Dimethyl-Dodeca-2,6,9-Trienal; 3,7-Dimethyl-8,11-Dioxo-2,6,9-Dodecatrienal |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| CAS Registry Number | 36518-11-3 |
| SMILES | C(\C=C(C(=O)\C=C\C(=O)C)/C)C\C(=C\C=O)C |
| InChI | 1S/C14H18O3/c1-11(9-10-15)5-4-6-12(2)14(17)8-7-13(3)16/h6-10H,4-5H2,1-3H3/b8-7+,11-9+,12-6+ |
| InChIKey | PQXIJIXNDRFJBT-WWUHPALESA-N |
| Density | 1.011g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.868°C at 760 mmHg (Cal.) |
| Flash point | 179.877°C (Cal.) |
| (1) | Schildknecht Hermann. Chemical Ecology?A Chapter of Modern Natural Products Chemistry, Angewandte Chemie International Edition in English, 1976 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2E,6E,9E)-3,7-Dimethyl-8,11-Dioxododeca-2,6,9-Trienal |