|
CAS#: 365411-50-3 Product: 7,7,8,9,9-Pentamethyl-4,4A,5,6,8,9B-Hexahydrocyclopenta[h][1,3]Benzodioxine No suppilers available for the product. |
| Name | 7,7,8,9,9-Pentamethyl-4,4A,5,6,8,9B-Hexahydrocyclopenta[h][1,3]Benzodioxine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 |
| CAS Registry Number | 365411-50-3 |
| SMILES | CC3(C)C\1=C(\CCC2COCOC/12)C(C)(C)C3C |
| InChI | 1S/C16H26O2/c1-10-15(2,3)12-7-6-11-8-17-9-18-14(11)13(12)16(10,4)5/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | NJQDALIDWNJDSW-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.983°C at 760 mmHg (Cal.) |
| Flash point | 157.055°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,7,8,9,9-Pentamethyl-4,4A,5,6,8,9B-Hexahydrocyclopenta[h][1,3]Benzodioxine |