| Name | Methyl 5-(4-Methoxyphenyl)-3,5-Dioxopentanoate |
|---|---|
| Synonyms | Methyl 5-(4-methoxyphenyl)-3,5-dioxopentanoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 |
| CAS Registry Number | 36568-14-6 |
| SMILES | O=C(OC)CC(=O)CC(=O)c1ccc(OC)cc1 |
| InChI | 1S/C13H14O5/c1-17-11-5-3-9(4-6-11)12(15)7-10(14)8-13(16)18-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | NAZWURQNMUDKDZ-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.407°C at 760 mmHg (Cal.) |
| Flash point | 171.76°C (Cal.) |
| (1) | Thomas Rahn, Franziska Bendrath, Martin Hein, Wolfgang Baumann, Haijun Jiao, Armin Börner, Alexander Villinger and Peter Langer. Synthesis and characterization of bis-cyclopropanated 1,3,5-tricarbonyl compounds. A combined synthetic, spectroscopic and theoretical study, Org. Biomol. Chem., 2011, 9, 5172. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 5-(4-Methoxyphenyl)-3,5-Dioxopentanoate |