|
CAS#: 36576-23-5 Product: 2,3-Dimethyl-4-Phenyldiazenylaniline No suppilers available for the product. |
| Name | 2,3-Dimethyl-4-Phenyldiazenylaniline |
|---|---|
| Synonyms | 2,3-Dimethyl-4-Phenylazo-Aniline; 2,3-Dimethyl-4-Phenylazoaniline; (2,3-Dimethyl-4-Phenylazo-Phenyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 |
| CAS Registry Number | 36576-23-5 |
| SMILES | C1=CC(=C(C(=C1N=NC2=CC=CC=C2)C)C)N |
| InChI | 1S/C14H15N3/c1-10-11(2)14(9-8-13(10)15)17-16-12-6-4-3-5-7-12/h3-9H,15H2,1-2H3 |
| InChIKey | ZYVVPQKFJIHXJE-UHFFFAOYSA-N |
| Density | 1.097g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.074°C at 760 mmHg (Cal.) |
| Flash point | 201.806°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-4-Phenyldiazenylaniline |