|
CAS#: 3660-62-6 Product: Ambelline No suppilers available for the product. |
| Name | Ambelline |
|---|---|
| Synonyms | Ambelline; C08517 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 |
| CAS Registry Number | 3660-62-6 |
| SMILES | [C@@]135[C@H](N(C[C@H]1O)CC4=C(OC)C2=C(OCO2)C=C34)C[C@@H](OC)C=C5 |
| InChI | 1S/C18H21NO5/c1-21-10-3-4-18-12-6-13-17(24-9-23-13)16(22-2)11(12)7-19(8-15(18)20)14(18)5-10/h3-4,6,10,14-15,20H,5,7-9H2,1-2H3/t10-,14+,15+,18+/m0/s1 |
| InChIKey | QAHZAHIPKNLGAS-QMJNRFBBSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.093°C at 760 mmHg (Cal.) |
| Flash point | 258.666°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ambelline |