|
CAS#: 36651-62-4 Product: 7-(Oxiran-2-Ylmethoxy)Chromen-2-One No suppilers available for the product. |
| Name | 7-(Oxiran-2-Ylmethoxy)Chromen-2-One |
|---|---|
| Synonyms | 7-(2-Oxiranylmethoxy)-2-Chromenone; 7-Glycidoxycoumarin; 2H-1-Benzopyran-2-One, 7-(Oxiranylmethoxy)-, (S-(R*,R*))- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 36651-62-4 |
| SMILES | C2=C1OC(=O)C=CC1=CC=C2OCC3OC3 |
| InChI | 1S/C12H10O4/c13-12-4-2-8-1-3-9(5-11(8)16-12)14-6-10-7-15-10/h1-5,10H,6-7H2 |
| InChIKey | LCXLBLMRJRRPQJ-UHFFFAOYSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.458°C at 760 mmHg (Cal.) |
| Flash point | 188.973°C (Cal.) |
| (1) | Rui Wang, Xuesong Jiang, Bing Yu and Jie Yin. Stimuli-responsive microgels formed by hyperbranched poly(ether amine) decorated with platinum nanoparticles, Soft Matter, 2011, 7, 8619. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-(Oxiran-2-Ylmethoxy)Chromen-2-One |