|
CAS#: 36704-23-1 Product: Styrene, Dicyclopentadiene Polymer No suppilers available for the product. |
| Name | Styrene, Dicyclopentadiene Polymer |
|---|---|
| Synonyms | 4,7-Methano-1H-Indene, 3A,4,7,7A-Tetrahydro-, Polymer With Ethenylbenzene |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 |
| CAS Registry Number | 36704-23-1 |
| SMILES | C3C1C(C2CC1C=C2)C=C3.C4=C(C=CC=C4)C=C |
| InChI | 1S/C10H12.C8H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-2-8-6-4-3-5-7-8/h1-2,4-5,7-10H,3,6H2;2-7H,1H2 |
| InChIKey | MRFIHIFFUCQAKD-UHFFFAOYSA-N |
| Boiling point | 170°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 46.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Styrene, Dicyclopentadiene Polymer |