|
CAS#: 36719-56-9 Product: N-(2,6-Dimethylphenyl)Diazenyl-N-Methylmethanamine No suppilers available for the product. |
| Name | N-(2,6-Dimethylphenyl)Diazenyl-N-Methylmethanamine |
|---|---|
| Synonyms | N-(2,6-Dimethylphenyl)Azo-N-Methyl-Methanamine; N-(2,6-Dimethylphenyl)Azo-N-Methylmethanamine; (2,6-Dimethylphenyl)Azo-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 |
| CAS Registry Number | 36719-56-9 |
| SMILES | C1=CC=C(C(=C1C)N=NN(C)C)C |
| InChI | 1S/C10H15N3/c1-8-6-5-7-9(2)10(8)11-12-13(3)4/h5-7H,1-4H3 |
| InChIKey | WISMGIJPTXABDJ-UHFFFAOYSA-N |
| Density | 0.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.312°C at 760 mmHg (Cal.) |
| Flash point | 113.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dimethylphenyl)Diazenyl-N-Methylmethanamine |