|
CAS#: 3674-73-5 Product: 2,3,5-Trimethylphenanthrene No suppilers available for the product. |
| Name | 2,3,5-Trimethylphenanthrene |
|---|---|
| Synonyms | 2,3,5-Trimethyl-Phenanthrene; Phenanthrene, 2,3,5-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 3674-73-5 |
| SMILES | C1=CC=C2C(=C1C)C3=C(C=C2)C=C(C(=C3)C)C |
| InChI | 1S/C17H16/c1-11-5-4-6-14-7-8-15-9-12(2)13(3)10-16(15)17(11)14/h4-10H,1-3H3 |
| InChIKey | PIRFDOCDTWKNTM-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.732°C at 760 mmHg (Cal.) |
| Flash point | 181.505°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5-Trimethylphenanthrene |