|
CAS#: 3682-56-2 Product: 2-Phenyldiazenylbenzoic Acid No suppilers available for the product. |
| Name | 2-Phenyldiazenylbenzoic Acid |
|---|---|
| Synonyms | 2-Phenylazobenzoic Acid; 2-[(E)-Phenyldiazenyl]Benzoic Acid; Benzoic Acid, 2-(Phenylazo)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 3682-56-2 |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC=C2)C(=O)O |
| InChI | 1S/C13H10N2O2/c16-13(17)11-8-4-5-9-12(11)15-14-10-6-2-1-3-7-10/h1-9H,(H,16,17) |
| InChIKey | UVOKEWIIBKIDIY-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.7°C at 760 mmHg (Cal.) |
| Flash point | 204.603°C (Cal.) |
| (1) | Masahito Sano, Ayumi Kamino and Seiji Shinkai. Hierarchical structures in mesoscopic fibers that are self-organized by monolayer nano-clusters, Phys. Chem. Chem. Phys., 2001, 3, 444. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Phenyldiazenylbenzoic Acid |