|
CAS#: 3682-94-8 Product: 2,2'-[(E)-1,2-Diazenediyl]Bis(2-Methylpropanamide) No suppilers available for the product. |
| Name | 2,2'-[(E)-1,2-Diazenediyl]Bis(2-Methylpropanamide) |
|---|---|
| Synonyms | a,a'-azodiisobutyramide; Propanamide,2,2'-(1,2-diazenediyl)bis[2-methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 3682-94-8 |
| SMILES | CC(C)(C(=O)N)/N=N/C(C)(C)C(=O)N |
| InChI | 1S/C8H16N4O2/c1-7(2,5(9)13)11-12-8(3,4)6(10)14/h1-4H3,(H2,9,13)(H2,10,14)/b12-11+ |
| InChIKey | OALMZWNBNXQUAL-VAWYXSNFSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.1±27.0°C at 760 mmHg (Cal.) |
| Flash point | 177.0±23.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[(E)-1,2-Diazenediyl]Bis(2-Methylpropanamide) |