| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 6,6'-Dimethyl-2,2'-Biphenyldiamine |
|---|---|
| Synonyms | (2'-amino-6,6'-dimethyl-2-biphenylyl)amine; (R)-(+)-6,6'-DIMETHYL-2,2'-BIPHENYLDIAMINE; (R)-2,2'-diamino-6,6'-dimethyl-1,1'-biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 3685-06-1 |
| SMILES | CC1=C(C(=CC=C1)N)C2=C(C=CC=C2N)C |
| InChI | 1S/C14H16N2/c1-9-5-3-7-11(15)13(9)14-10(2)6-4-8-12(14)16/h3-8H,15-16H2,1-2H3 |
| InChIKey | MCUUKQCKNKUMBP-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.4±37.0°C at 760 mmHg (Cal.) |
| Flash point | 189.1±26.0°C (Cal.) |
| (1) | Furen Zhang, Haibin Song and Guofu Zi. Synthesis and catalytic activity of group 5 metal amides with chiral biaryldiamine-based ligands, Dalton Trans., 2011, 40, 1547. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6,6'-Dimethyl-2,2'-Biphenyldiamine |