|
CAS#: 36882-17-4 Product: Sodium 2-Di(Phenyl)Phosphanylbenzoate No suppilers available for the product. |
| Name | Sodium 2-Di(Phenyl)Phosphanylbenzoate |
|---|---|
| Synonyms | Benzoic Acid, 2-(Diphenylphosphino)-, Sodium Salt; Sodium 2-(Diphenylphosphine)Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14NaO2P |
| Molecular Weight | 328.28 |
| CAS Registry Number | 36882-17-4 |
| EINECS | 253-254-1 |
| SMILES | C3=C(P(C1=CC=CC=C1)C2=CC=CC=C2)C(=CC=C3)C([O-])=O.[Na+] |
| InChI | 1S/C19H15O2P.Na/c20-19(21)17-13-7-8-14-18(17)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1-14H,(H,20,21);/q;+1/p-1 |
| InChIKey | LOCKDMJLLDIFLY-UHFFFAOYSA-M |
| Boiling point | 451°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 226.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-Di(Phenyl)Phosphanylbenzoate |