|
CAS#: 36919-88-7 Product: 1-Propan-2-Yl-2-(2-Propan-2-Ylphenyl)Benzene No suppilers available for the product. |
| Name | 1-Propan-2-Yl-2-(2-Propan-2-Ylphenyl)Benzene |
|---|---|
| Synonyms | 1-Isopropyl-2-(2-Isopropylphenyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 36919-88-7 |
| SMILES | C1=CC=CC(=C1C2=C(C=CC=C2)C(C)C)C(C)C |
| InChI | 1S/C18H22/c1-13(2)15-9-5-7-11-17(15)18-12-8-6-10-16(18)14(3)4/h5-14H,1-4H3 |
| InChIKey | MZVCUTVPCIOAJD-UHFFFAOYSA-N |
| Density | 0.935g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.797°C at 760 mmHg (Cal.) |
| Flash point | 173.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Propan-2-Yl-2-(2-Propan-2-Ylphenyl)Benzene |