Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Cicloprofen |
|---|---|
| Synonyms | 2-(9H-Fluoren-2-Yl)Propionic Acid; Aids128650 |
| Molecular Structure |  |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 |
| CAS Registry Number | 36950-96-6 |
| EINECS | 253-287-1 |
| SMILES | C1=CC(=CC3=C1C2=C(C=CC=C2)C3)C(C(O)=O)C |
| InChI | 1S/C16H14O2/c1-10(16(17)18)11-6-7-15-13(8-11)9-12-4-2-3-5-14(12)15/h2-8,10H,9H2,1H3,(H,17,18) |
| InChIKey | LRXFKKPEBXIPMW-UHFFFAOYSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.244°C at 760 mmHg (Cal.) |
| Flash point | 319.974°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cicloprofen |