|
CAS#: 36983-28-5 Product: Propan-2-Yl 2,4-Dioxopentanoate No suppilers available for the product. |
| Name | Propan-2-Yl 2,4-Dioxopentanoate |
|---|---|
| Synonyms | Isopropyl 2,4-Dioxopentanoate; 2,4-Dioxopentanoic Acid Isopropyl Ester; 2,4-Diketovaleric Acid Isopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 36983-28-5 |
| EINECS | 253-296-0 |
| SMILES | C(C(=O)C(OC(C)C)=O)C(=O)C |
| InChI | 1S/C8H12O4/c1-5(2)12-8(11)7(10)4-6(3)9/h5H,4H2,1-3H3 |
| InChIKey | MTWDPRMKRJQPIO-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.004°C at 760 mmHg (Cal.) |
| Flash point | 91.562°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propan-2-Yl 2,4-Dioxopentanoate |