|
CAS#: 37011-64-6 Product: 5-hydroxy-7-phenyl-1H,6H-benzo[de]isochromene-1,6-dione No suppilers available for the product. |
| Name | 5-hydroxy-7-phenyl-1H,6H-benzo[de]isochromene-1,6-dione |
|---|---|
| Synonyms | Nsc154708; 1H,6H-Naphtho[1,8-Cd]Pyran-1,6-Dione, 5-Hydroxy-7-Phenyl-; 5-Hydroxy-7-Phenyl-Benzo[De]Isochromene-1,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C18H10O4 |
| Molecular Weight | 290.27 |
| CAS Registry Number | 37011-64-6 |
| SMILES | C1=C4C3=C(C(=C1)C2=CC=CC=C2)C(=O)C(=CC3=COC4=O)O |
| InChI | 1S/C18H10O4/c19-14-8-11-9-22-18(21)13-7-6-12(10-4-2-1-3-5-10)16(15(11)13)17(14)20/h1-9,19H |
| InChIKey | TUROAXCIAPETPG-UHFFFAOYSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.61°C at 760 mmHg (Cal.) |
| Flash point | 226.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-hydroxy-7-phenyl-1H,6H-benzo[de]isochromene-1,6-dione |