|
CAS#: 37052-13-4 Product: 1H-Phenanthro(9,10-D)Imidazol-2-Amine No suppilers available for the product. |
| Name | 1H-Phenanthro(9,10-D)Imidazol-2-Amine |
|---|---|
| Synonyms | 2-Aminophenanthroimidazole; Phenanthroimidazole-2-Amine; 1H-Phenanthro[9,10-D]Imidazol-2-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 |
| CAS Registry Number | 37052-13-4 |
| SMILES | C1=CC3=C(C=C1)C2=C([NH]C(=N2)N)C4=C3C=CC=C4 |
| InChI | 1S/C15H11N3/c16-15-17-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)18-15/h1-8H,(H3,16,17,18) |
| InChIKey | NRAODPUCVPCBOK-UHFFFAOYSA-N |
| Density | 1.409g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.912°C at 760 mmHg (Cal.) |
| Flash point | 326.179°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Phenanthro(9,10-D)Imidazol-2-Amine |