|
CAS#: 37133-74-7 Product: 12,13-Epoxytrichothec-9-Ene No suppilers available for the product. |
| Name | 12,13-Epoxytrichothec-9-Ene |
|---|---|
| Synonyms | Trichothec-9-Ene, 12,13-Epoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 37133-74-7 |
| SMILES | [C@@]12(OC1)[C@]3([C@@]4([C@H](O[C@@H]2CC3)C=C(CC4)C)C)C |
| InChI | 1S/C15H22O2/c1-10-4-6-13(2)12(8-10)17-11-5-7-14(13,3)15(11)9-16-15/h8,11-12H,4-7,9H2,1-3H3/t11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | LZAJKCZTKKKZNT-QMIVOQANSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.73°C at 760 mmHg (Cal.) |
| Flash point | 153.939°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12,13-Epoxytrichothec-9-Ene |